Type: Neutral
Formula: C15H22ClN3O3S
SMILES: |
Clc1cc(ccc1)C(=O)NNC(=O)C(O)C(N)CCSC(C)C |
InChI: |
InChI=1/C15H22ClN3O3S/c1-9(2)23-7-6-12(17)13(20)15(22)19-18-14(21)10-4-3-5-11(16)8-10/h3-5,8-9,12-13,20H,6-7,17H2,1-2H3,(H,18,21)(H,19,22)/t12-,13+/m1/s1 |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 359.878 g/mol | logS: -3.88668 | SlogP: 1.3209 | Reactive groups: 0 |
| | | |
Topological Properties | | | |
Globularity: 0.0315577 | Sterimol/B1: 2.28916 | Sterimol/B2: 3.49924 | Sterimol/B3: 3.79534 |
Sterimol/B4: 7.31647 | Sterimol/L: 19.9609 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 638.617 | Positive charged surface: 346.411 | Negative charged surface: 292.206 | Volume: 328.875 |
Hydrophobic surface: 400.526 | Hydrophilic surface: 238.091 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 4 | Hydrogen bond acceptors: 4 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 2 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | |
|
search links for this molecule: |
|
 |
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |