Type: Ionized
Formula: C7H8O9P-3
SMILES: |
P(O)(O)(=O)C(CCC(=O)[O-])(CC(=O)[O-])C(=O)[O-] |
InChI: |
InChI=1/C7H11O9P/c8-4(9)1-2-7(6(12)13,3-5(10)11)17(14,15)16/h1-3H2,(H,8,9)(H,10,11)(H,12,13)(H2,14,15,16)/p-3/t7-/m1/s1 |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 267.106 g/mol | logS: 0.3445 | SlogP: -5.7473 | Reactive groups: 0 |
| | | |
Topological Properties | | | |
Globularity: 0.364777 | Sterimol/B1: 3.67947 | Sterimol/B2: 4.22263 | Sterimol/B3: 4.61087 |
Sterimol/B4: 4.84531 | Sterimol/L: 10.8336 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 387.962 | Positive charged surface: 142.959 | Negative charged surface: 245.003 | Volume: 187.75 |
Hydrophobic surface: 58.4399 | Hydrophilic surface: 329.5221 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 3 | Hydrogen bond acceptors: 3 | Acid groups: 6 | Basic groups: 0 |
Chiral centers: 1 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 0 | |
|
search links for this molecule: |
|
 |
|
|
Parent related molecule:
|