Type: Neutral
Formula: C11H15N5O3S
SMILES: |
S(C)C1C(O)C(OC1n1c2ncnc(N)c2nc1)CO |
InChI: |
InChI=1/C11H15N5O3S/c1-20-8-7(18)5(2-17)19-11(8)16-4-15-6-9(12)13-3-14-10(6)16/h3-5,7-8,11,17-18H,2H2,1H3,(H2,12,13,14)/t5-,7+,8-,11-/m0/s1 |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 297.339 g/mol | logS: -2.1571 | SlogP: -0.5138 | Reactive groups: 0 |
| | | |
Topological Properties | | | |
Globularity: 0.0935359 | Sterimol/B1: 2.50554 | Sterimol/B2: 2.68598 | Sterimol/B3: 3.97702 |
Sterimol/B4: 8.3044 | Sterimol/L: 13.7763 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 495.02 | Positive charged surface: 363.818 | Negative charged surface: 131.202 | Volume: 256 |
Hydrophobic surface: 224.31 | Hydrophilic surface: 270.71 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 3 | Hydrogen bond acceptors: 6 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 4 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | |
|
search links for this molecule: |
|
 |
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |