Type: Neutral
Formula: C11H12N3O5-
SMILES: |
O1C(CO)C(O)C([O-])C1n1c2NC=NC(=O)c2cc1 |
InChI: |
InChI=1/C11H12N3O5/c15-3-6-7(16)8(17)11(19-6)14-2-1-5-9(14)12-4-13-10(5)18/h1-2,4,6-8,11,15-16H,3H2,(H,12,13,18)/q-1/t6-,7-,8-,11-/m1/s1 |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 266.233 g/mol | logS: -0.37233 | SlogP: -0.7727 | Reactive groups: 0 |
| | | |
Topological Properties | | | |
Globularity: 0.0784238 | Sterimol/B1: 2.45383 | Sterimol/B2: 3.00226 | Sterimol/B3: 3.42512 |
Sterimol/B4: 6.72891 | Sterimol/L: 12.6795 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 428.35 | Positive charged surface: 252.235 | Negative charged surface: 176.115 | Volume: 221.625 |
Hydrophobic surface: 197.67 | Hydrophilic surface: 230.68 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 3 | Hydrogen bond acceptors: 5 | Acid groups: 1 | Basic groups: 0 |
Chiral centers: 4 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | |
|
search links for this molecule: |
|
 |
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |