Type: Neutral
Formula: C9H14N5O4P
SMILES: |
P(O)(O)(=O)COC(Cn1c2ncnc(N)c2nc1)C |
InChI: |
InChI=1/C9H14N5O4P/c1-6(18-5-19(15,16)17)2-14-4-13-7-8(10)11-3-12-9(7)14/h3-4,6H,2,5H2,1H3,(H2,10,11,12)(H2,15,16,17)/t6-/m1/s1 |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 287.216 g/mol | logS: -0.90392 | SlogP: -0.855 | Reactive groups: 0 |
| | | |
Topological Properties | | | |
Globularity: 0.201542 | Sterimol/B1: 2.66388 | Sterimol/B2: 4.03763 | Sterimol/B3: 4.44792 |
Sterimol/B4: 6.92869 | Sterimol/L: 12.2661 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 466.982 | Positive charged surface: 326.795 | Negative charged surface: 140.187 | Volume: 238.125 |
Hydrophobic surface: 173.363 | Hydrophilic surface: 293.619 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 4 | Hydrogen bond acceptors: 7 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 1 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | |
|
search links for this molecule: |
|
 |
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |