 |
 |
|
 |
Search | Help | MolPaint | Roadmap | Credits | Feedback |
| SMILES: | OC(=O)C(NC(=O)C(Cc1ccccc1)CC(=O)NO)C |
| InChI: | InChI=1/C14H18N2O5/c1-9(14(19)20)15-13(18)11(8-12(17)16-21)7-10-5-3-2-4-6-10/h2-6,9,11,21H,7-8H2,1H3,(H,15,18)(H,16,17)(H,19,20)/t9-,11+/m0/s1 |
 |
|
| download 2D Mol File
| download 3D Mol File
Potential Energy Epot(MMFF94)=71.1427 kcal/mol |
MOE's Descriptors
| Physical Properties | ||||||
| Molecular Weight: 294.307 g/mol | logS: -1.63588 | SlogP: 0.33007 | Reactive groups: 0 | |||
| Topological Properties | ||||||
| Globularity: 0.0792653 | Sterimol/B1: 2.90626 | Sterimol/B2: 4.14937 | Sterimol/B3: 5.07415 | |||
| Sterimol/B4: 5.72891 | Sterimol/L: 15.359 | |||||
| Surface and Volume Properties | ||||||
| Accessible surface: 523.324 | Positive charged surface: 312.179 | Negative charged surface: 211.145 | Volume: 268 | |||
| Hydrophobic surface: 285.73 | Hydrophilic surface: 237.594 | |||||
| Pharmacophoric Properties | ||||||
| Hydrogen bond donors: 5 | Hydrogen bond acceptors: 5 | Acid groups: 0 | Basic groups: 0 | |||
| Chiral centers: 2 | ||||||
| Drug- and Lead-like Properties | ||||||
| Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | ||||
|
