Type: Neutral
Formula: C6H13O10P
SMILES: |
P(OCC(O)C(O)C(O)C(O)C(O)=O)(O)(O)=O |
InChI: |
InChI=1/C6H13O10P/c7-2(1-16-17(13,14)15)3(8)4(9)5(10)6(11)12/h2-5,7-10H,1H2,(H,11,12)(H2,13,14,15)/t2-,3-,4+,5-/m1/s1 |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 276.134 g/mol | logS: 1.63874 | SlogP: -4.4463 | Reactive groups: 0 |
| | | |
Topological Properties | | | |
Globularity: 0.0641669 | Sterimol/B1: 2.69101 | Sterimol/B2: 3.48155 | Sterimol/B3: 3.60022 |
Sterimol/B4: 3.67869 | Sterimol/L: 14.6739 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 444.29 | Positive charged surface: 248.936 | Negative charged surface: 195.354 | Volume: 200.875 |
Hydrophobic surface: 74.0313 | Hydrophilic surface: 370.2587 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 9 | Hydrogen bond acceptors: 10 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 4 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 1 | Oprea's lead like rule: 0 | |
|
search links for this molecule: |
|
 |
|
|
Ions/Tautomers related molecules
|