Type: Neutral
Formula: C19H24N4O
| SMILES: |
O=C(NCCc1ccccc1)C1CCCN(C1)c1nc(ccn1)C |
| InChI: |
InChI=1/C19H24N4O/c1-15-9-11-21-19(22-15)23-13-5-8-17(14-23)18(24)20-12-10-16-6-3-2-4-7-16/h2-4,6-7,9,11,17H,5,8,10,12-14H2,1H3,(H,20,24)/t17-/m0/s1 |
MOE's Descriptors
| Physical Properties | | | |
| Molecular Weight: 324.428 g/mol | logS: -3.44108 | SlogP: 2.36029 | Reactive groups: 0 |
| | | | |
| Topological Properties | | | |
| Globularity: 0.0367533 | Sterimol/B1: 2.75382 | Sterimol/B2: 3.50144 | Sterimol/B3: 3.9803 |
| Sterimol/B4: 7.13298 | Sterimol/L: 19.127 | | | |
| | | | |
| Surface and Volume Properties | | | |
| Accessible surface: 626.133 | Positive charged surface: 447.763 | Negative charged surface: 178.37 | Volume: 332.5 |
| Hydrophobic surface: 560.268 | Hydrophilic surface: 65.865 | | |
| | | | |
| Pharmacophoric Properties | | | |
| Hydrogen bond donors: 1 | Hydrogen bond acceptors: 3 | Acid groups: 0 | Basic groups: 0 |
| Chiral centers: 1 | | | |
| | | | |
| Drug- and Lead-like Properties | | | |
| Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | |
| |
search links for this molecule: |
|
 |
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |