Type: Neutral
Formula: C19H24N4O
SMILES: |
O=C(NCCc1ccccc1)C1CCCN(C1)c1nc(ccn1)C |
InChI: |
InChI=1/C19H24N4O/c1-15-9-11-21-19(22-15)23-13-5-8-17(14-23)18(24)20-12-10-16-6-3-2-4-7-16/h2-4,6-7,9,11,17H,5,8,10,12-14H2,1H3,(H,20,24)/t17-/m1/s1 |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 324.428 g/mol | logS: -3.44108 | SlogP: 2.36029 | Reactive groups: 0 |
| | | |
Topological Properties | | | |
Globularity: 0.0368285 | Sterimol/B1: 2.76208 | Sterimol/B2: 3.50123 | Sterimol/B3: 3.97989 |
Sterimol/B4: 7.13257 | Sterimol/L: 19.219 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 625.745 | Positive charged surface: 450.818 | Negative charged surface: 174.927 | Volume: 331.75 |
Hydrophobic surface: 561.956 | Hydrophilic surface: 63.789 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 1 | Hydrogen bond acceptors: 3 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 1 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | |
|
search links for this molecule: |
|
 |
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |