Type: Neutral
Formula: C10H15N3O5
SMILES: |
O1C(CO)C(O)C(OC)C1N1C=CC(=NC1=O)N |
InChI: |
InChI=1/C10H15N3O5/c1-17-8-7(15)5(4-14)18-9(8)13-3-2-6(11)12-10(13)16/h2-3,5,7-9,14-15H,4H2,1H3,(H2,11,12,16)/t5-,7-,8+,9+/m0/s1 |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 257.246 g/mol | logS: -0.41759 | SlogP: -1.614 | Reactive groups: 0 |
| | | |
Topological Properties | | | |
Globularity: 0.123824 | Sterimol/B1: 2.15694 | Sterimol/B2: 3.68752 | Sterimol/B3: 3.80697 |
Sterimol/B4: 8.67164 | Sterimol/L: 11.8354 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 449.586 | Positive charged surface: 324.99 | Negative charged surface: 124.596 | Volume: 220.625 |
Hydrophobic surface: 207.743 | Hydrophilic surface: 241.843 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 3 | Hydrogen bond acceptors: 6 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 4 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | |
|
search links for this molecule: |
|
![](img/zinc.png) |
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |