Type: Neutral
Formula: C18H21N3O3S
SMILES: |
S(=O)(=O)(N1CC(CCC1)C(=O)NCc1cccnc1)c1ccccc1 |
InChI: |
InChI=1/C18H21N3O3S/c22-18(20-13-15-6-4-10-19-12-15)16-7-5-11-21(14-16)25(23,24)17-8-2-1-3-9-17/h1-4,6,8-10,12,16H,5,7,11,13-14H2,(H,20,22)/t16-/m0/s1 |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 359.45 g/mol | logS: -2.28963 | SlogP: 2.0651 | Reactive groups: 0 |
| | | |
Topological Properties | | | |
Globularity: 0.0497717 | Sterimol/B1: 2.97327 | Sterimol/B2: 3.40065 | Sterimol/B3: 4.94438 |
Sterimol/B4: 6.30556 | Sterimol/L: 19.1022 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 612.186 | Positive charged surface: 388.831 | Negative charged surface: 223.356 | Volume: 333.25 |
Hydrophobic surface: 500.266 | Hydrophilic surface: 111.92 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 1 | Hydrogen bond acceptors: 4 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 1 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | |
|
search links for this molecule: |
|
 |
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |