Type: Neutral
Formula: C17H19N3O3S2
SMILES: |
s1ccnc1NS(=O)(=O)c1ccc(NC(=O)C2C3CC(C2)CC3)cc1 |
InChI: |
InChI=1/C17H19N3O3S2/c21-16(15-10-11-1-2-12(15)9-11)19-13-3-5-14(6-4-13)25(22,23)20-17-18-7-8-24-17/h3-8,11-12,15H,1-2,9-10H2,(H,18,20)(H,19,21)/t11-,12+,15+/m0/s1 |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 377.489 g/mol | logS: -4.98788 | SlogP: 3.3186 | Reactive groups: 0 |
| | | |
Topological Properties | | | |
Globularity: 0.0532919 | Sterimol/B1: 3.13958 | Sterimol/B2: 3.86158 | Sterimol/B3: 4.33375 |
Sterimol/B4: 6.24607 | Sterimol/L: 17.4624 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 585.938 | Positive charged surface: 359.112 | Negative charged surface: 226.825 | Volume: 325.625 |
Hydrophobic surface: 445.099 | Hydrophilic surface: 140.839 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 2 | Hydrogen bond acceptors: 4 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 3 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | |
|
search links for this molecule: |
|
 |
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |