Type: Neutral
Formula: C19H24N4O3S
SMILES: |
S(=O)(=O)(NC(=O)NC1CCCCC1)c1cnccc1Nc1cc(ccc1)C |
InChI: |
InChI=1/C19H24N4O3S/c1-14-6-5-9-16(12-14)21-17-10-11-20-13-18(17)27(25,26)23-19(24)22-15-7-3-2-4-8-15/h5-6,9-13,15H,2-4,7-8H2,1H3,(H,20,21)(H2,22,23,24) |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 388.492 g/mol | logS: -3.95852 | SlogP: 3.45422 | Reactive groups: 0 |
| | | |
Topological Properties | | | |
Globularity: 0.0890028 | Sterimol/B1: 2.11115 | Sterimol/B2: 3.92081 | Sterimol/B3: 4.87198 |
Sterimol/B4: 9.46567 | Sterimol/L: 17.2538 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 639.648 | Positive charged surface: 446.287 | Negative charged surface: 193.361 | Volume: 355.75 |
Hydrophobic surface: 518.46 | Hydrophilic surface: 121.188 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 3 | Hydrogen bond acceptors: 4 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 0 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | |
|
search links for this molecule: |
|
 |
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |