Type: Neutral
Formula: C21H25N3O2
SMILES: |
O=C(NCc1cccnc1)c1ccc(NC(=O)CC2CCCCC2)cc1 |
InChI: |
InChI=1/C21H25N3O2/c25-20(13-16-5-2-1-3-6-16)24-19-10-8-18(9-11-19)21(26)23-15-17-7-4-12-22-14-17/h4,7-12,14,16H,1-3,5-6,13,15H2,(H,23,26)(H,24,25) |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 351.45 g/mol | logS: -4.92605 | SlogP: 4.1869 | Reactive groups: 0 |
| | | |
Topological Properties | | | |
Globularity: 0.0446631 | Sterimol/B1: 2.53477 | Sterimol/B2: 3.36648 | Sterimol/B3: 4.62078 |
Sterimol/B4: 5.2916 | Sterimol/L: 21.1413 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 654.915 | Positive charged surface: 467.478 | Negative charged surface: 187.436 | Volume: 352.375 |
Hydrophobic surface: 558.542 | Hydrophilic surface: 96.373 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 2 | Hydrogen bond acceptors: 3 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 0 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | |
|
search links for this molecule: |
|
 |
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |