Type: Neutral
Formula: C16H24N2O3S
SMILES: |
S=C(NC(C)c1cc(OC)ccc1OC)NCC1OCCC1 |
InChI: |
InChI=1/C16H24N2O3S/c1-11(14-9-12(19-2)6-7-15(14)20-3)18-16(22)17-10-13-5-4-8-21-13/h6-7,9,11,13H,4-5,8,10H2,1-3H3,(H2,17,18,22)/t11-,13+/m1/s1 |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 324.445 g/mol | logS: -3.71186 | SlogP: 2.5034 | Reactive groups: 1 |
| | | |
Topological Properties | | | |
Globularity: 0.0557143 | Sterimol/B1: 2.26656 | Sterimol/B2: 3.31127 | Sterimol/B3: 5.61735 |
Sterimol/B4: 8.3581 | Sterimol/L: 16.3642 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 607.622 | Positive charged surface: 458.797 | Negative charged surface: 148.825 | Volume: 315.875 |
Hydrophobic surface: 485.327 | Hydrophilic surface: 122.295 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 2 | Hydrogen bond acceptors: 4 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 2 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | |
|
search links for this molecule: |
|
|
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |