Type: Neutral
Formula: C22H31NO2
SMILES: |
O(CC(=O)NC1C2CC3CC1CC(C2)C3)c1ccc(cc1)C(C)(C)C |
InChI: |
InChI=1/C22H31NO2/c1-22(2,3)18-4-6-19(7-5-18)25-13-20(24)23-21-16-9-14-8-15(11-16)12-17(21)10-14/h4-7,14-17,21H,8-13H2,1-3H3,(H,23,24)/t14-,15+,16-,17+,21- |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 341.495 g/mol | logS: -6.32845 | SlogP: 4.3038 | Reactive groups: 0 |
| | | |
Topological Properties | | | |
Globularity: 0.0441629 | Sterimol/B1: 2.76508 | Sterimol/B2: 4.04736 | Sterimol/B3: 4.21373 |
Sterimol/B4: 5.13075 | Sterimol/L: 18.8259 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 625.523 | Positive charged surface: 448.063 | Negative charged surface: 177.459 | Volume: 354.25 |
Hydrophobic surface: 529.651 | Hydrophilic surface: 95.872 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 1 | Hydrogen bond acceptors: 2 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 0 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | |
|
search links for this molecule: |
|
 |
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |