Type: Neutral
Formula: C15H15ClN4O2S
SMILES: |
Clc1ccc(cc1)C1N(C(=S)NC)C(Cc2[nH]cnc12)C(O)=O |
InChI: |
InChI=1/C15H15ClN4O2S/c1-17-15(23)20-11(14(21)22)6-10-12(19-7-18-10)13(20)8-2-4-9(16)5-3-8/h2-5,7,11,13H,6H2,1H3,(H,17,23)(H,18,19)(H,21,22)/t11-,13-/m1/s1 |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 350.83 g/mol | logS: -4.31178 | SlogP: 2.06357 | Reactive groups: 0 |
| | | |
Topological Properties | | | |
Globularity: 0.172463 | Sterimol/B1: 3.03516 | Sterimol/B2: 3.4144 | Sterimol/B3: 4.33801 |
Sterimol/B4: 8.62993 | Sterimol/L: 12.9065 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 509.659 | Positive charged surface: 320.561 | Negative charged surface: 189.098 | Volume: 293.5 |
Hydrophobic surface: 356.978 | Hydrophilic surface: 152.681 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 5 | Hydrogen bond acceptors: 5 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 2 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | |
|
search links for this molecule: |
|
|
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |