Type: Neutral
Formula: C21H30O3
SMILES: |
O=C1CCC2(C3C(C4CCC(C(=O)C)C4(CC3)C)CCC2=C1)CO |
InChI: |
InChI=1/C21H30O3/c1-13(23)17-5-6-18-16-4-3-14-11-15(24)7-10-21(14,12-22)19(16)8-9-20(17,18)2/h11,16-19,22H,3-10,12H2,1-2H3/t16-,17-,18-,19+,20-,21-/m1/s1 |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 330.468 g/mol | logS: -4.5455 | SlogP: 3.6959 | Reactive groups: 1 |
| | | |
Topological Properties | | | |
Globularity: 0.169973 | Sterimol/B1: 2.19771 | Sterimol/B2: 2.86546 | Sterimol/B3: 4.89156 |
Sterimol/B4: 6.38644 | Sterimol/L: 14.6542 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 512.956 | Positive charged surface: 346.196 | Negative charged surface: 166.76 | Volume: 330.75 |
Hydrophobic surface: 389.847 | Hydrophilic surface: 123.109 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 1 | Hydrogen bond acceptors: 3 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 6 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | |
|
search links for this molecule: |
|
 |
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |