Type: Neutral
Formula: C17H20N2O2
SMILES: |
OC1CCCCC1NC(=O)Nc1c2c(ccc1)cccc2 |
InChI: |
InChI=1/C17H20N2O2/c20-16-11-4-3-9-15(16)19-17(21)18-14-10-5-7-12-6-1-2-8-13(12)14/h1-2,5-8,10,15-16,20H,3-4,9,11H2,(H2,18,19,21)/t15-,16-/m0/s1 |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 284.359 g/mol | logS: -4.05945 | SlogP: 3.2648 | Reactive groups: 0 |
| | | |
Topological Properties | | | |
Globularity: 0.0676644 | Sterimol/B1: 3.33793 | Sterimol/B2: 3.72789 | Sterimol/B3: 4.73925 |
Sterimol/B4: 6.50457 | Sterimol/L: 16.163 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 528.595 | Positive charged surface: 344.393 | Negative charged surface: 173.845 | Volume: 281.25 |
Hydrophobic surface: 440.007 | Hydrophilic surface: 88.588 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 3 | Hydrogen bond acceptors: 2 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 2 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | |
|
search links for this molecule: |
|
|
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |