Type: Neutral
Formula: C12H15NO
SMILES: |
O=CNC1CCCCc2c1cccc2 |
InChI: |
InChI=1/C12H15NO/c14-9-13-12-8-4-2-6-10-5-1-3-7-11(10)12/h1,3,5,7,9,12H,2,4,6,8H2,(H,13,14)/t12-/m0/s1 |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 189.258 g/mol | logS: -2.84337 | SlogP: 2.29557 | Reactive groups: 0 |
| | | |
Topological Properties | | | |
Globularity: 0.230316 | Sterimol/B1: 2.4271 | Sterimol/B2: 3.07918 | Sterimol/B3: 4.00296 |
Sterimol/B4: 7.58823 | Sterimol/L: 9.9072 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 391.664 | Positive charged surface: 263.149 | Negative charged surface: 128.515 | Volume: 198.375 |
Hydrophobic surface: 317.503 | Hydrophilic surface: 74.161 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 1 | Hydrogen bond acceptors: 1 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 1 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | |
|
search links for this molecule: |
|
 |
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |