Type: Neutral
Formula: C15H20O8
SMILES: |
O1\C(=C/C(OCC)=O)\C(C2CC1(O)C1OC2CO1)C(OCC)=O |
InChI: |
InChI=1/C15H20O8/c1-3-19-11(16)5-9-12(13(17)20-4-2)8-6-15(18,23-9)14-21-7-10(8)22-14/h5,8,10,12,14,18H,3-4,6-7H2,1-2H3/b9-5-/t8-,10+,12-,14+,15+/m1/s1 |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 328.317 g/mol | logS: -2.15406 | SlogP: 0.0929 | Reactive groups: 0 |
| | | |
Topological Properties | | | |
Globularity: 0.157358 | Sterimol/B1: 3.50126 | Sterimol/B2: 4.96394 | Sterimol/B3: 5.89435 |
Sterimol/B4: 7.26469 | Sterimol/L: 13.1718 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 552.478 | Positive charged surface: 409.822 | Negative charged surface: 142.656 | Volume: 285 |
Hydrophobic surface: 373.407 | Hydrophilic surface: 179.071 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 1 | Hydrogen bond acceptors: 6 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 5 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | |
|
search links for this molecule: |
|
 |
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |