Type: Neutral
Formula: C9H15N5O3
SMILES: |
O=C1NC(=NC=2NCC(NC1=2)C(O)C(O)C)N |
InChI: |
InChI=1/C9H15N5O3/c1-3(15)6(16)4-2-11-7-5(12-4)8(17)14-9(10)13-7/h3-4,6,12,15-16H,2H2,1H3,(H4,10,11,13,14,17)/t3-,4-,6-/m0/s1 |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 241.251 g/mol | logS: -0.63897 | SlogP: -3.0969 | Reactive groups: 0 |
| | | |
Topological Properties | | | |
Globularity: 0.17546 | Sterimol/B1: 2.16373 | Sterimol/B2: 2.3621 | Sterimol/B3: 5.0148 |
Sterimol/B4: 6.1376 | Sterimol/L: 12.1572 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 419.886 | Positive charged surface: 314.376 | Negative charged surface: 105.511 | Volume: 206.125 |
Hydrophobic surface: 124.144 | Hydrophilic surface: 295.742 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 6 | Hydrogen bond acceptors: 4 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 3 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 1 | Oprea's lead like rule: 1 | |
|
search links for this molecule: |
|
 |
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |