Type: Neutral
Formula: C11H17N7O5
SMILES: |
O=C1NC(=O)NN=C1CC(=O)NC(CCCNC(N)=N)C(O)=O |
InChI: |
InChI=1/C11H17N7O5/c12-10(13)14-3-1-2-5(9(21)22)15-7(19)4-6-8(20)16-11(23)18-17-6/h5H,1-4H2,(H,15,19)(H,21,22)(H4,12,13,14)(H2,16,18,20,23)/t5-/m0/s1 |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 327.301 g/mol | logS: -1.45293 | SlogP: -2.59543 | Reactive groups: 0 |
| | | |
Topological Properties | | | |
Globularity: 0.057234 | Sterimol/B1: 3.33962 | Sterimol/B2: 4.0561 | Sterimol/B3: 5.1488 |
Sterimol/B4: 6.23516 | Sterimol/L: 17.2125 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 564.855 | Positive charged surface: 372.644 | Negative charged surface: 192.211 | Volume: 274.25 |
Hydrophobic surface: 123.868 | Hydrophilic surface: 440.987 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 8 | Hydrogen bond acceptors: 7 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 1 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 0 | Violations of Lipinski's rule: 2 | Oprea's lead like rule: 0 | |
|
search links for this molecule: |
|
![](img/zinc.png) |
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |