Type: Neutral
Formula: C17H14N4S2
SMILES: |
s1c2c(nc1Nc1ncnc3sc4CCCCc4c13)cccc2 |
InChI: |
InChI=1/C17H14N4S2/c1-3-7-12-10(5-1)14-15(18-9-19-16(14)22-12)21-17-20-11-6-2-4-8-13(11)23-17/h2,4,6,8-9H,1,3,5,7H2,(H,18,19,20,21) |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 338.459 g/mol | logS: -6.85991 | SlogP: 4.92334 | Reactive groups: 0 |
| | | |
Topological Properties | | | |
Globularity: 0.0132238 | Sterimol/B1: 2.8935 | Sterimol/B2: 2.98732 | Sterimol/B3: 2.9921 |
Sterimol/B4: 7.5959 | Sterimol/L: 16.457 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 543.032 | Positive charged surface: 333.044 | Negative charged surface: 204.687 | Volume: 300.75 |
Hydrophobic surface: 433.738 | Hydrophilic surface: 109.294 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 1 | Hydrogen bond acceptors: 3 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 0 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 0 | |
|
search links for this molecule: |
|
 |
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |