Type: Neutral
Formula: C20H19N5O3S3
SMILES: |
s1c2cc(ccc2nc1NC(=O)C1CCCN(S(=O)(=O)c2c3nsnc3ccc2)C1)C |
InChI: |
InChI=1/C20H19N5O3S3/c1-12-7-8-14-16(10-12)29-20(21-14)22-19(26)13-4-3-9-25(11-13)31(27,28)17-6-2-5-15-18(17)24-30-23-15/h2,5-8,10,13H,3-4,9,11H2,1H3,(H,21,22,26)/t13-/m0/s1 |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 473.602 g/mol | logS: -5.87425 | SlogP: 3.64882 | Reactive groups: 0 |
| | | |
Topological Properties | | | |
Globularity: 0.0370453 | Sterimol/B1: 4.13933 | Sterimol/B2: 4.62066 | Sterimol/B3: 4.70306 |
Sterimol/B4: 6.47875 | Sterimol/L: 20.1019 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 696.652 | Positive charged surface: 407.922 | Negative charged surface: 288.731 | Volume: 395.625 |
Hydrophobic surface: 482.278 | Hydrophilic surface: 214.374 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 1 | Hydrogen bond acceptors: 6 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 1 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 0 | |
|
search links for this molecule: |
|
|
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |