Type: Neutral
Formula: C17H22N2O10
SMILES: |
O1C(CNC(=O)c2cc([N+](=O)[O-])c(cc2)COC(=O)C)C(O)C(O)C(O)C1OC |
InChI: |
InChI=1/C17H22N2O10/c1-8(20)28-7-10-4-3-9(5-11(10)19(25)26)16(24)18-6-12-13(21)14(22)15(23)17(27-2)29-12/h3-5,12-15,17,21-23H,6-7H2,1-2H3,(H,18,24)/t12-,13-,14-,15-,17+/m0/s1 |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 414.367 g/mol | logS: -2.41756 | SlogP: -0.8919 | Reactive groups: 0 |
| | | |
Topological Properties | | | |
Globularity: 0.0281735 | Sterimol/B1: 1.969 | Sterimol/B2: 3.06272 | Sterimol/B3: 3.54541 |
Sterimol/B4: 9.37444 | Sterimol/L: 17.6556 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 655.941 | Positive charged surface: 411.839 | Negative charged surface: 244.102 | Volume: 352 |
Hydrophobic surface: 373.262 | Hydrophilic surface: 282.679 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 4 | Hydrogen bond acceptors: 7 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 5 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 1 | Oprea's lead like rule: 1 | |
|
search links for this molecule: |
|
 |
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |