Type: Neutral
Formula: C4H8O10P2
SMILES: |
P(O)(O)(=O)C(C(P(O)(O)=O)C(O)=O)C(O)=O |
InChI: |
InChI=1/C4H8O10P2/c5-3(6)1(15(9,10)11)2(4(7)8)16(12,13)14/h1-2H,(H,5,6)(H,7,8)(H2,9,10,11)(H2,12,13,14)/t1-,2+ |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 278.046 g/mol | logS: 1.75682 | SlogP: -3.8922 | Reactive groups: 0 |
| | | |
Topological Properties | | | |
Globularity: 0.202022 | Sterimol/B1: 2.6793 | Sterimol/B2: 3.45631 | Sterimol/B3: 4.6276 |
Sterimol/B4: 4.67744 | Sterimol/L: 9.93052 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 384.767 | Positive charged surface: 202.928 | Negative charged surface: 181.839 | Volume: 177.875 |
Hydrophobic surface: 22.1751 | Hydrophilic surface: 362.5919 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 10 | Hydrogen bond acceptors: 10 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 2 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 1 | Oprea's lead like rule: 0 | |
|
search links for this molecule: |
|
|
|
|
Ions/Tautomers related molecules
|