Type: Neutral
Formula: C11H15N5O5
SMILES: |
O1C(CO)C(CN=[N+]=[N-])C(O)C1N1C=C(C)C(=O)NC1=O |
InChI: |
InChI=1/C11H15N5O5/c1-5-3-16(11(20)14-9(5)19)10-8(18)6(2-13-15-12)7(4-17)21-10/h3,6-8,10,17-18H,2,4H2,1H3,(H,14,19,20)/t6-,7+,8-,10+/m1/s1 |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 297.271 g/mol | logS: -0.33359 | SlogP: -0.5534 | Reactive groups: 1 |
| | | |
Topological Properties | | | |
Globularity: 0.137569 | Sterimol/B1: 2.06414 | Sterimol/B2: 3.32888 | Sterimol/B3: 3.95928 |
Sterimol/B4: 6.86467 | Sterimol/L: 13.317 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 470.434 | Positive charged surface: 279.259 | Negative charged surface: 191.176 | Volume: 245.75 |
Hydrophobic surface: 213.564 | Hydrophilic surface: 256.87 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 3 | Hydrogen bond acceptors: 7 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 4 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | |
|
search links for this molecule: |
|
 |
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |