Type: Neutral
Formula: C12H18N2O6
SMILES: |
O1C(CO)C(O)CC(N2C=CC(=O)NC2=O)C1OCC |
InChI: |
InChI=1/C12H18N2O6/c1-2-19-11-7(5-8(16)9(6-15)20-11)14-4-3-10(17)13-12(14)18/h3-4,7-9,11,15-16H,2,5-6H2,1H3,(H,13,17,18)/t7-,8+,9+,11-/m1/s1 |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 286.284 g/mol | logS: -0.74581 | SlogP: -1.0748 | Reactive groups: 0 |
| | | |
Topological Properties | | | |
Globularity: 0.231211 | Sterimol/B1: 2.53709 | Sterimol/B2: 4.05804 | Sterimol/B3: 4.18269 |
Sterimol/B4: 6.77923 | Sterimol/L: 13.6954 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 470.11 | Positive charged surface: 332.221 | Negative charged surface: 137.889 | Volume: 250.125 |
Hydrophobic surface: 256.294 | Hydrophilic surface: 213.816 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 3 | Hydrogen bond acceptors: 6 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 4 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | |
|
search links for this molecule: |
|
 |
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |