Type: Neutral
Formula: C12H17FN2O7
SMILES: |
FC1=CN(C2C(O)C(OC2CO)C(OC)OC)C(=O)NC1=O |
InChI: |
InChI=1/C12H17FN2O7/c1-20-11(21-2)9-8(17)7(6(4-16)22-9)15-3-5(13)10(18)14-12(15)19/h3,6-9,11,16-17H,4H2,1-2H3,(H,14,18,19)/t6-,7+,8+,9+/m0/s1 |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 320.273 g/mol | logS: -0.74871 | SlogP: -1.4339 | Reactive groups: 0 |
| | | |
Topological Properties | | | |
Globularity: 0.151125 | Sterimol/B1: 3.72205 | Sterimol/B2: 4.41893 | Sterimol/B3: 4.74668 |
Sterimol/B4: 5.29616 | Sterimol/L: 13.3749 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 504.693 | Positive charged surface: 349.778 | Negative charged surface: 154.915 | Volume: 262.125 |
Hydrophobic surface: 276.583 | Hydrophilic surface: 228.11 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 3 | Hydrogen bond acceptors: 7 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 4 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | |
|
search links for this molecule: |
|
 |
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |