Type: Neutral
Formula: C5H10O10S2
SMILES: |
S(OC1C(OS(O)(=O)=O)COCC1O)(O)(=O)=O |
InChI: |
InChI=1/C5H10O10S2/c6-3-1-13-2-4(14-16(7,8)9)5(3)15-17(10,11)12/h3-6H,1-2H2,(H,7,8,9)(H,10,11,12)/t3-,4+,5+/m0/s1 |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 294.257 g/mol | logS: -0.2297 | SlogP: -3.3779 | Reactive groups: 0 |
| | | |
Topological Properties | | | |
Globularity: 0.113826 | Sterimol/B1: 2.3044 | Sterimol/B2: 3.29494 | Sterimol/B3: 3.44521 |
Sterimol/B4: 7.56783 | Sterimol/L: 11.5248 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 408.3 | Positive charged surface: 213.668 | Negative charged surface: 194.632 | Volume: 187.625 |
Hydrophobic surface: 110.541 | Hydrophilic surface: 297.759 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 7 | Hydrogen bond acceptors: 10 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 3 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | |
|
search links for this molecule: |
|
 |
|
|
Ions/Tautomers related molecules
|