Type: Neutral
Formula: C11H16N2O6
SMILES: |
O1C(CO)(C)C(O)C(O)C1N1C=C(C)C(=O)NC1=O |
InChI: |
InChI=1/C11H16N2O6/c1-5-3-13(10(18)12-8(5)17)9-6(15)7(16)11(2,4-14)19-9/h3,6-7,9,14-16H,4H2,1-2H3,(H,12,17,18)/t6-,7-,9+,11+/m0/s1 |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 272.257 g/mol | logS: -0.21581 | SlogP: -1.7289 | Reactive groups: 0 |
| | | |
Topological Properties | | | |
Globularity: 0.151813 | Sterimol/B1: 2.54989 | Sterimol/B2: 3.04889 | Sterimol/B3: 4.50102 |
Sterimol/B4: 5.21755 | Sterimol/L: 12.7932 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 455.479 | Positive charged surface: 307.325 | Negative charged surface: 148.154 | Volume: 233.5 |
Hydrophobic surface: 219.48 | Hydrophilic surface: 235.999 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 4 | Hydrogen bond acceptors: 6 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 4 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | |
|
search links for this molecule: |
|
|
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |