Type: Neutral
Formula: C14H22N2O6
SMILES: |
O1C(CO)C(OC(OCC)C)CC1N1C=C(C)C(=O)NC1=O |
InChI: |
InChI=1/C14H22N2O6/c1-4-20-9(3)21-10-5-12(22-11(10)7-17)16-6-8(2)13(18)15-14(16)19/h6,9-12,17H,4-5,7H2,1-3H3,(H,15,18,19)/t9-,10-,11+,12+/m0/s1 |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 314.338 g/mol | logS: -1.31588 | SlogP: 0.317 | Reactive groups: 0 |
| | | |
Topological Properties | | | |
Globularity: 0.156306 | Sterimol/B1: 1.969 | Sterimol/B2: 3.23148 | Sterimol/B3: 4.95241 |
Sterimol/B4: 9.02887 | Sterimol/L: 14.9814 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 561.646 | Positive charged surface: 385.084 | Negative charged surface: 176.562 | Volume: 288.875 |
Hydrophobic surface: 340.042 | Hydrophilic surface: 221.604 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 2 | Hydrogen bond acceptors: 6 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 4 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | |
|
search links for this molecule: |
|
|
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |