 |
 |
|
 |
Search | Help | MolPaint | Roadmap | Credits | Feedback |
| SMILES: | S1CN(CN(C(C)C)C1=S)C(C(=O)NC1C2SCC(C)=C(N2C1=O)C(O)=O)c1cccc c1 |
| InChI: | InChI=1/C22H26N4O4S3/c1-12(2)25-10-24(11-33-22(25)31)17(14-7-5-4-6-8-14)18(27)23-15-19(28)26-16(21(29)30)13(3)9-32-20(15)26/h4-8,12,15,17,20H,9-11H2,1-3H3,(H,23,27)(H,29,30)/t15-,17+,20+/m1/s1 |
 |
|
| download 2D Mol File
| download 3D Mol File
Potential Energy Epot(MMFF94)=143.533 kcal/mol |
MOE's Descriptors
| Physical Properties | ||||||
| Molecular Weight: 506.672 g/mol | logS: -6.05051 | SlogP: 2.5408 | Reactive groups: 0 | |||
| Topological Properties | ||||||
| Globularity: 0.0464708 | Sterimol/B1: 3.5276 | Sterimol/B2: 4.17352 | Sterimol/B3: 4.94709 | |||
| Sterimol/B4: 7.08337 | Sterimol/L: 18.9293 | |||||
| Surface and Volume Properties | ||||||
| Accessible surface: 736.216 | Positive charged surface: 386.128 | Negative charged surface: 324.522 | Volume: 442.625 | |||
| Hydrophobic surface: 401 | Hydrophilic surface: 335.216 | |||||
| Pharmacophoric Properties | ||||||
| Hydrogen bond donors: 3 | Hydrogen bond acceptors: 6 | Acid groups: 0 | Basic groups: 0 | |||
| Chiral centers: 3 | ||||||
| Drug- and Lead-like Properties | ||||||
| Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 1 | Oprea's lead like rule: 1 | ||||
|
Ions/Tautomers related molecules
