Type: Neutral
Formula: C17H15FN2O5
SMILES: |
Fc1ccc(cc1)C#CC1=CN(C2OC(CO)C(O)C2)C(=O)NC1=O |
InChI: |
InChI=1/C17H15FN2O5/c18-12-5-2-10(3-6-12)1-4-11-8-20(17(24)19-16(11)23)15-7-13(22)14(9-21)25-15/h2-3,5-6,8,13-15,21-22H,7,9H2,(H,19,23,24)/t13-,14+,15-/m1/s1 |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 346.314 g/mol | logS: -3.27667 | SlogP: 0.081108 | Reactive groups: 0 |
| | | |
Topological Properties | | | |
Globularity: 0.0510136 | Sterimol/B1: 4.12085 | Sterimol/B2: 4.20964 | Sterimol/B3: 4.32691 |
Sterimol/B4: 5.21686 | Sterimol/L: 18.4847 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 586.496 | Positive charged surface: 339.659 | Negative charged surface: 246.837 | Volume: 300.125 |
Hydrophobic surface: 379.142 | Hydrophilic surface: 207.354 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 3 | Hydrogen bond acceptors: 5 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 3 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | |
|
search links for this molecule: |
|
 |
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |