Type: Neutral
Formula: C18H15F3N2O5
| SMILES: |
FC(F)(F)c1ccc(cc1)C#CC1=CN(C2OC(CO)C(O)C2)C(=O)NC1=O |
| InChI: |
InChI=1/C18H15F3N2O5/c19-18(20,21)12-5-2-10(3-6-12)1-4-11-8-23(17(27)22-16(11)26)15-7-13(25)14(9-24)28-15/h2-3,5-6,8,13-15,24-25H,7,9H2,(H,22,26,27)/t13-,14+,15-/m1/s1 |
MOE's Descriptors
| Physical Properties | | | |
| Molecular Weight: 396.321 g/mol | logS: -4.03824 | SlogP: 1.27231 | Reactive groups: 0 |
| | | | |
| Topological Properties | | | |
| Globularity: 0.0418861 | Sterimol/B1: 3.96738 | Sterimol/B2: 4.17342 | Sterimol/B3: 4.36928 |
| Sterimol/B4: 5.17873 | Sterimol/L: 19.3439 | | | |
| | | | |
| Surface and Volume Properties | | | |
| Accessible surface: 627.268 | Positive charged surface: 320.194 | Negative charged surface: 307.074 | Volume: 323.25 |
| Hydrophobic surface: 316.021 | Hydrophilic surface: 311.247 | | |
| | | | |
| Pharmacophoric Properties | | | |
| Hydrogen bond donors: 3 | Hydrogen bond acceptors: 5 | Acid groups: 0 | Basic groups: 0 |
| Chiral centers: 3 | | | |
| | | | |
| Drug- and Lead-like Properties | | | |
| Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | |
| |
search links for this molecule: |
|
 |
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |