Type: Neutral
Formula: C11H16ClFN2O5
SMILES: |
ClC1(C)C(OC)N(C2OC(CO)C(F)C2)C(=O)NC1=O |
InChI: |
InChI=1/C11H16ClFN2O5/c1-11(12)8(17)14-10(18)15(9(11)19-2)7-3-5(13)6(4-16)20-7/h5-7,9,16H,3-4H2,1-2H3,(H,14,17,18)/t5-,6-,7-,9-,11-/m0/s1 |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 310.709 g/mol | logS: -1.64548 | SlogP: 0.7934 | Reactive groups: 0 |
| | | |
Topological Properties | | | |
Globularity: 0.29142 | Sterimol/B1: 2.1212 | Sterimol/B2: 3.47664 | Sterimol/B3: 5.58821 |
Sterimol/B4: 5.94175 | Sterimol/L: 12.3318 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 469.016 | Positive charged surface: 293.568 | Negative charged surface: 175.448 | Volume: 250.75 |
Hydrophobic surface: 219.725 | Hydrophilic surface: 249.291 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 2 | Hydrogen bond acceptors: 5 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 5 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | |
|
search links for this molecule: |
|
 |
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |