Type: Neutral
Formula: C11H16N2O6
SMILES: |
O1C(CO)C(O)CC1N1C=C(OCC)C(=O)NC1=O |
InChI: |
InChI=1/C11H16N2O6/c1-2-18-7-4-13(11(17)12-10(7)16)9-3-6(15)8(5-14)19-9/h4,6,8-9,14-15H,2-3,5H2,1H3,(H,12,16,17)/t6-,8+,9-/m1/s1 |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 272.257 g/mol | logS: -0.68958 | SlogP: -1.1157 | Reactive groups: 0 |
| | | |
Topological Properties | | | |
Globularity: 0.117224 | Sterimol/B1: 2.55751 | Sterimol/B2: 4.03009 | Sterimol/B3: 4.46811 |
Sterimol/B4: 6.03175 | Sterimol/L: 14.2087 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 482.752 | Positive charged surface: 341.557 | Negative charged surface: 141.195 | Volume: 233.375 |
Hydrophobic surface: 237.915 | Hydrophilic surface: 244.837 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 3 | Hydrogen bond acceptors: 6 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 3 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | |
|
search links for this molecule: |
|
 |
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |