Type: Neutral
Formula: C11H13F3N2O7
SMILES: |
FC(F)(F)COC1=CN(C2OC(CO)C(O)C2O)C(=O)NC1=O |
InChI: |
InChI=1/C11H13F3N2O7/c12-11(13,14)3-22-4-1-16(10(21)15-8(4)20)9-7(19)6(18)5(2-17)23-9/h1,5-7,9,17-19H,2-3H2,(H,15,20,21)/t5-,6+,7+,9-/m0/s1 |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 342.226 g/mol | logS: -1.04105 | SlogP: -1.1826 | Reactive groups: 0 |
| | | |
Topological Properties | | | |
Globularity: 0.103322 | Sterimol/B1: 2.98498 | Sterimol/B2: 3.82593 | Sterimol/B3: 4.93792 |
Sterimol/B4: 5.82917 | Sterimol/L: 12.4264 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 502.133 | Positive charged surface: 282.487 | Negative charged surface: 219.646 | Volume: 250.875 |
Hydrophobic surface: 148.431 | Hydrophilic surface: 353.702 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 4 | Hydrogen bond acceptors: 7 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 4 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | |
|
search links for this molecule: |
|
 |
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |