 |
 |
|
 |
Search | Help | MolPaint | Roadmap | Credits | Feedback |
| SMILES: | P(OCC1OC(N2C=NC(=NC2=O)N)C([O-])C1O)(=O)([O-])[O-] |
| InChI: | InChI=1/C8H12N4O8P/c9-7-10-2-12(8(15)11-7)6-5(14)4(13)3(20-6)1-19-21(16,17)18/h2-6,13H,1H2,(H2,9,11,15)(H2,16,17,18)/q-1/p-2/t3-,4+,5+,6+/m0/s1 |
 |
|
| download 2D Mol File
| download 3D Mol File
Potential Energy Epot(MMFF94)=-31.9722 kcal/mol |
MOE's Descriptors
| Physical Properties | ||||||
| Molecular Weight: 321.162 g/mol | logS: -0.2363 | SlogP: -4.575 | Reactive groups: 0 | |||
| Topological Properties | ||||||
| Globularity: 0.0837724 | Sterimol/B1: 2.70094 | Sterimol/B2: 4.13243 | Sterimol/B3: 4.62546 | |||
| Sterimol/B4: 5.82701 | Sterimol/L: 14.9477 | |||||
| Surface and Volume Properties | ||||||
| Accessible surface: 481.98 | Positive charged surface: 226.934 | Negative charged surface: 255.046 | Volume: 229.375 | |||
| Hydrophobic surface: 92.0991 | Hydrophilic surface: 389.8809 | |||||
| Pharmacophoric Properties | ||||||
| Hydrogen bond donors: 2 | Hydrogen bond acceptors: 6 | Acid groups: 4 | Basic groups: 0 | |||
| Chiral centers: 4 | ||||||
| Drug- and Lead-like Properties | ||||||
| Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 1 | Oprea's lead like rule: 0 | ||||
|
