 |
 |
|
 |
Search | Help | MolPaint | Roadmap | Credits | Feedback |
| SMILES: | P(OCC1OC(N2C=NC(=NC2=O)N)C(O)C1O)(=O)([O-])[O-] |
| InChI: | InChI=1/C8H13N4O8P/c9-7-10-2-12(8(15)11-7)6-5(14)4(13)3(20-6)1-19-21(16,17)18/h2-6,13-14H,1H2,(H2,9,11,15)(H2,16,17,18)/p-2/t3-,4+,5+,6-/m0/s1 |
 |
|
| download 2D Mol File
| download 3D Mol File
Potential Energy Epot(MMFF94)=-66.3819 kcal/mol |
MOE's Descriptors
| Physical Properties | ||||||
| Molecular Weight: 322.17 g/mol | logS: -0.16478 | SlogP: -5.0132 | Reactive groups: 0 | |||
| Topological Properties | ||||||
| Globularity: 0.0952049 | Sterimol/B1: 2.55119 | Sterimol/B2: 3.326 | Sterimol/B3: 3.55477 | |||
| Sterimol/B4: 4.96222 | Sterimol/L: 15.7089 | |||||
| Surface and Volume Properties | ||||||
| Accessible surface: 453.699 | Positive charged surface: 250.889 | Negative charged surface: 202.81 | Volume: 227.625 | |||
| Hydrophobic surface: 105.14 | Hydrophilic surface: 348.559 | |||||
| Pharmacophoric Properties | ||||||
| Hydrogen bond donors: 3 | Hydrogen bond acceptors: 7 | Acid groups: 3 | Basic groups: 0 | |||
| Chiral centers: 4 | ||||||
| Drug- and Lead-like Properties | ||||||
| Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 1 | Oprea's lead like rule: 0 | ||||
|
