Type: Neutral
Formula: C10H13FN2O4
SMILES: |
FC1CC(OC1N1C=C(C)C(=O)NC1=O)CO |
InChI: |
InChI=1/C10H13FN2O4/c1-5-3-13(10(16)12-8(5)15)9-7(11)2-6(4-14)17-9/h3,6-7,9,14H,2,4H2,1H3,(H,12,15,16)/t6-,7-,9-/m1/s1 |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 244.222 g/mol | logS: -0.81914 | SlogP: 0.3073 | Reactive groups: 0 |
| | | |
Topological Properties | | | |
Globularity: 0.123598 | Sterimol/B1: 2.63364 | Sterimol/B2: 3.46208 | Sterimol/B3: 4.23338 |
Sterimol/B4: 4.51947 | Sterimol/L: 12.9046 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 426.946 | Positive charged surface: 271.522 | Negative charged surface: 155.424 | Volume: 204 |
Hydrophobic surface: 227.637 | Hydrophilic surface: 199.309 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 2 | Hydrogen bond acceptors: 4 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 3 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | |
|
search links for this molecule: |
|
 |
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |