Type: Neutral
Formula: C10H14N2O7
SMILES: |
O1C(C(O)CO)C(O)C(O)C1N1C=CC(=O)NC1=O |
InChI: |
InChI=1/C10H14N2O7/c13-3-4(14)8-6(16)7(17)9(19-8)12-2-1-5(15)11-10(12)18/h1-2,4,6-9,13-14,16-17H,3H2,(H,11,15,18)/t4-,6+,7-,8+,9-/m1/s1 |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 274.229 g/mol | logS: 0.33089 | SlogP: -3.1482 | Reactive groups: 0 |
| | | |
Topological Properties | | | |
Globularity: 0.103796 | Sterimol/B1: 2.5033 | Sterimol/B2: 3.12216 | Sterimol/B3: 3.77539 |
Sterimol/B4: 7.24494 | Sterimol/L: 12.4701 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 436.839 | Positive charged surface: 283.877 | Negative charged surface: 152.962 | Volume: 220.625 |
Hydrophobic surface: 155.965 | Hydrophilic surface: 280.874 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 5 | Hydrogen bond acceptors: 7 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 5 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | |
|
search links for this molecule: |
|
 |
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |