Type: Neutral
Formula: C9H13N3O6
| SMILES: |
O1C(CO)C(O)C(O)C1N1C=CC(=NC1=O)NO |
| InChI: |
InChI=1/C9H13N3O6/c13-3-4-6(14)7(15)8(18-4)12-2-1-5(11-17)10-9(12)16/h1-2,4,6-8,13-15,17H,3H2,(H,10,11,16)/t4-,6+,7+,8-/m0/s1 |
MOE's Descriptors
| Physical Properties | | | |
| Molecular Weight: 259.218 g/mol | logS: 0.1242 | SlogP: -2.248 | Reactive groups: 0 |
| | | | |
| Topological Properties | | | |
| Globularity: 0.0795303 | Sterimol/B1: 2.84883 | Sterimol/B2: 3.23245 | Sterimol/B3: 3.6355 |
| Sterimol/B4: 5.40558 | Sterimol/L: 13.9842 | | | |
| | | | |
| Surface and Volume Properties | | | |
| Accessible surface: 434.068 | Positive charged surface: 298.185 | Negative charged surface: 135.883 | Volume: 209.75 |
| Hydrophobic surface: 163.609 | Hydrophilic surface: 270.459 | | |
| | | | |
| Pharmacophoric Properties | | | |
| Hydrogen bond donors: 5 | Hydrogen bond acceptors: 7 | Acid groups: 0 | Basic groups: 0 |
| Chiral centers: 4 | | | |
| | | | |
| Drug- and Lead-like Properties | | | |
| Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | |
| |
search links for this molecule: |
|
 |
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |