Type: Neutral
Formula: C9H11ClN2O5
| SMILES: |
ClC1C(O)C(OC1CO)N1C=CC(=O)NC1=O |
| InChI: |
InChI=1/C9H11ClN2O5/c10-6-4(3-13)17-8(7(6)15)12-2-1-5(14)11-9(12)16/h1-2,4,6-8,13,15H,3H2,(H,11,14,16)/t4-,6+,7+,8+/m0/s1 |
MOE's Descriptors
| Physical Properties | | | |
| Molecular Weight: 262.649 g/mol | logS: -0.83947 | SlogP: -0.8427 | Reactive groups: 0 |
| | | | |
| Topological Properties | | | |
| Globularity: 0.0963344 | Sterimol/B1: 2.54884 | Sterimol/B2: 3.26848 | Sterimol/B3: 3.50548 |
| Sterimol/B4: 6.59266 | Sterimol/L: 11.6003 | | | |
| | | | |
| Surface and Volume Properties | | | |
| Accessible surface: 412.133 | Positive charged surface: 228.422 | Negative charged surface: 183.711 | Volume: 204.625 |
| Hydrophobic surface: 143.676 | Hydrophilic surface: 268.457 | | |
| | | | |
| Pharmacophoric Properties | | | |
| Hydrogen bond donors: 3 | Hydrogen bond acceptors: 5 | Acid groups: 0 | Basic groups: 0 |
| Chiral centers: 4 | | | |
| | | | |
| Drug- and Lead-like Properties | | | |
| Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | |
| |
search links for this molecule: |
|
 |
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |