Type: Neutral
Formula: C10H14ClFN2O6
SMILES: |
ClC1(F)C(OC)N(C2OC(CO)C(O)C2)C(=O)NC1=O |
InChI: |
InChI=1/C10H14ClFN2O6/c1-19-8-10(11,12)7(17)13-9(18)14(8)6-2-4(16)5(3-15)20-6/h4-6,8,15-16H,2-3H2,1H3,(H,13,17,18)/t4-,5-,6-,8+,10+/m0/s1 |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 312.681 g/mol | logS: -1.17169 | SlogP: -0.6966 | Reactive groups: 0 |
| | | |
Topological Properties | | | |
Globularity: 0.197369 | Sterimol/B1: 2.56107 | Sterimol/B2: 2.76782 | Sterimol/B3: 5.54983 |
Sterimol/B4: 6.08251 | Sterimol/L: 12.5104 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 456.004 | Positive charged surface: 269.558 | Negative charged surface: 186.446 | Volume: 241.375 |
Hydrophobic surface: 166.479 | Hydrophilic surface: 289.525 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 3 | Hydrogen bond acceptors: 6 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 5 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | |
|
search links for this molecule: |
|
 |
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |