Type: Neutral
Formula: C9H13N3O5
SMILES: |
O1C(CO)C(N)C(O)C1N1C=CC(=O)NC1=O |
InChI: |
InChI=1/C9H13N3O5/c10-6-4(3-13)17-8(7(6)15)12-2-1-5(14)11-9(12)16/h1-2,4,6-8,13,15H,3,10H2,(H,11,14,16)/t4-,6+,7+,8+/m0/s1 |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 243.219 g/mol | logS: 0.23445 | SlogP: -2.5427 | Reactive groups: 0 |
| | | |
Topological Properties | | | |
Globularity: 0.0994978 | Sterimol/B1: 2.55601 | Sterimol/B2: 3.33424 | Sterimol/B3: 3.37134 |
Sterimol/B4: 6.48158 | Sterimol/L: 11.3814 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 405.704 | Positive charged surface: 259.916 | Negative charged surface: 145.788 | Volume: 201 |
Hydrophobic surface: 142.383 | Hydrophilic surface: 263.321 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 4 | Hydrogen bond acceptors: 6 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 4 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | |
|
search links for this molecule: |
|
 |
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |