Type: Neutral
Formula: C12H16N4O3S2
SMILES: |
S(CC)C1C(O)C(OC1CO)n1c2NC=NC(=S)c2nc1 |
InChI: |
InChI=1/C12H16N4O3S2/c1-2-21-9-6(3-17)19-12(8(9)18)16-5-15-7-10(16)13-4-14-11(7)20/h4-6,8-9,12,17-18H,2-3H2,1H3,(H,13,14,20)/t6-,8+,9+,12-/m0/s1 |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 328.417 g/mol | logS: -3.38964 | SlogP: 0.4802 | Reactive groups: 0 |
| | | |
Topological Properties | | | |
Globularity: 0.153629 | Sterimol/B1: 2.47828 | Sterimol/B2: 4.18217 | Sterimol/B3: 4.30008 |
Sterimol/B4: 8.3735 | Sterimol/L: 14.751 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 535.185 | Positive charged surface: 358.508 | Negative charged surface: 176.676 | Volume: 281.5 |
Hydrophobic surface: 252.976 | Hydrophilic surface: 282.209 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 3 | Hydrogen bond acceptors: 6 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 4 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | |
|
search links for this molecule: |
|
|
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |