 |
 |
|
 |
Search | Help | MolPaint | Roadmap | Credits | Feedback |
| SMILES: | O(Cc1ccccc1)C(=O)NC(Cc1ccccc1)C(=O)NNC(=O)C([NH3+])C(C)C |
| InChI: | InChI=1/C22H28N4O4/c1-15(2)19(23)21(28)26-25-20(27)18(13-16-9-5-3-6-10-16)24-22(29)30-14-17-11-7-4-8-12-17/h3-12,15,18-19H,13-14,23H2,1-2H3,(H,24,29)(H,25,27)(H,26,28)/p+1/t18-,19-/m1/s1 |
 |
|
| download 2D Mol File
| download 3D Mol File
Potential Energy Epot(MMFF94)=70.9607 kcal/mol |
MOE's Descriptors
| Physical Properties | ||||||
| Molecular Weight: 413.498 g/mol | logS: -4.29198 | SlogP: 1.20437 | Reactive groups: 0 | |||
| Topological Properties | ||||||
| Globularity: 0.0633828 | Sterimol/B1: 3.1316 | Sterimol/B2: 4.4332 | Sterimol/B3: 5.43171 | |||
| Sterimol/B4: 8.54966 | Sterimol/L: 19.7142 | |||||
| Surface and Volume Properties | ||||||
| Accessible surface: 771.085 | Positive charged surface: 479.333 | Negative charged surface: 291.753 | Volume: 412.75 | |||
| Hydrophobic surface: 549.631 | Hydrophilic surface: 221.454 | |||||
| Pharmacophoric Properties | ||||||
| Hydrogen bond donors: 3 | Hydrogen bond acceptors: 3 | Acid groups: 0 | Basic groups: 1 | |||
| Chiral centers: 2 | ||||||
| Drug- and Lead-like Properties | ||||||
| Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | ||||
|
