Type: Neutral
Formula: C12H16BrN3O5
SMILES: |
BrCC(=O)NCC1OC(N2C=C(C)C(=O)NC2=O)CC1O |
InChI: |
InChI=1/C12H16BrN3O5/c1-6-5-16(12(20)15-11(6)19)10-2-7(17)8(21-10)4-14-9(18)3-13/h5,7-8,10,17H,2-4H2,1H3,(H,14,18)(H,15,19,20)/t7-,8-,10+/m0/s1 |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 362.18 g/mol | logS: -1.76155 | SlogP: -0.571 | Reactive groups: 1 |
| | | |
Topological Properties | | | |
Globularity: 0.0841024 | Sterimol/B1: 2.26801 | Sterimol/B2: 2.70389 | Sterimol/B3: 4.23827 |
Sterimol/B4: 8.67298 | Sterimol/L: 15.2187 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 534.26 | Positive charged surface: 301.276 | Negative charged surface: 232.984 | Volume: 275.875 |
Hydrophobic surface: 235.878 | Hydrophilic surface: 298.382 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 3 | Hydrogen bond acceptors: 5 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 3 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | |
|
search links for this molecule: |
|
 |
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |